CAS 35050-55-6
:Tomaymycin
Description:
Tomaymycin is a natural product classified as an antibiotic, primarily derived from the fermentation of the bacterium Streptomyces. It exhibits a complex molecular structure characterized by a polycyclic core, which contributes to its biological activity. Tomaymycin is known for its potent antimicrobial properties, particularly against certain Gram-positive bacteria and some fungi. The compound functions by inhibiting protein synthesis, thereby disrupting the growth and reproduction of susceptible microorganisms. Its mechanism of action involves binding to the ribosomal subunit, which is crucial for translating mRNA into proteins. Tomaymycin has been studied for its potential therapeutic applications, particularly in treating infections caused by resistant strains of bacteria. However, like many antibiotics, its use may be limited by factors such as toxicity, resistance development, and the need for further clinical evaluation. Overall, Tomaymycin represents an important compound in the field of natural product chemistry and antibiotic research, highlighting the ongoing need for effective antimicrobial agents.
Formula:C16H20N2O4
InChI:InChI=1S/C16H20N2O4/c1-4-9-5-12-15(22-3)17-11-7-13(19)14(21-2)6-10(11)16(20)18(12)8-9/h4,6-7,12,15,17,19H,5,8H2,1-3H3/b9-4+/t12-,15+/m0/s1
InChI key:InChIKey=UQVNRKBFAXNOGA-LWTNMJDUSA-N
SMILES:O=C1N2[C@]([C@@H](OC)NC=3C1=CC(OC)=C(O)C3)(C/C(=C\C)/C2)[H]
Synonyms:- 5H-Pyrrolo[2,1-c][1,4]benzodiazepin-5-one, 2-ethylidene-1,2,3,10,11,11a-hexahydro-8-hydroxy-7,11-dimethoxy-, (2E,11R,11aS)-
- (2E,11R,11aS)-2-Ethylidene-1,2,3,10,11,11a-hexahydro-8-hydroxy-7,11-dimethoxy-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one
- NSC 177499
- 5H-Pyrrolo[2,1-c][1,4]benzodiazepin-5-one, 2-ethylidene-1,2,3,10,11,11a-hexahydro-8-hydroxy-7,11-dimethoxy-, [11R-(2E,11α,11aβ)]-
- Tomaymycin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tomaymycin
CAS:Tomaymycin, an antitumor antibiotic, exhibits antimicrobial activity against Gram-positive bacteria [1] [2].Formula:C16H20N2O4Color and Shape:SolidMolecular weight:304.34
