CAS 350586-56-0: Notoginsenoside N

Description:Notoginsenoside N is a saponin compound derived from Panax notoginseng, a traditional medicinal plant known for its various health benefits. This compound is characterized by its complex glycosidic structure, which contributes to its biological activity. Notoginsenoside N exhibits properties such as anti-inflammatory, antioxidant, and neuroprotective effects, making it of interest in pharmacological research. Its mechanism of action often involves modulation of signaling pathways related to cell survival and apoptosis. The substance is typically studied for its potential therapeutic applications in conditions like cardiovascular diseases and neurodegenerative disorders. Additionally, Notoginsenoside N is soluble in organic solvents, which facilitates its extraction and purification from plant sources. As with many saponins, it may also exhibit surface-active properties, influencing its behavior in biological systems. Overall, Notoginsenoside N represents a significant area of study within natural product chemistry and pharmacognosy, highlighting the importance of plant-derived compounds in modern medicine.

Formula:C₄₈H₈₂O₁₉

InChI:InChI=1S/C48H82O19/c1-21(2)10-9-13-48(8,67-43-37(60)34(57)32(55)26(19-50)64-43)22-11-15-46(6)30(22)23(52)16-28-45(5)14-12-29(53)44(3,4)40(45)24(17-47(28,46)7)62-41-38(61)35(58)39(27(20-51)65-41)66-42-36(59)33(56)31(54)25(18-49)63-42/h10,22-43,49-61H,9,11-20H2,1-8H3/t22-,23+,24-,25+,26+,27+,28+,29-,30-,31+,32+,33-,34-,35+,36+,37+,38+,39+,40-,41+,42+,43-,45+,46+,47+,48-/m0/s1

InChI key:InChIKey=XYDGLABNHGXTRN-GFODNYKDSA-N

SMILES:OCC1OC(OC2C(O)C(O)C(OC2CO)OC3CC4(C)C(CC(O)C5C(CCC54C)C(OC6OC(CO)C(O)C(O)C6O)(C)CCC=C(C)C)C7(C)CCC(O)C(C)(C)C37)C(O)C(O)C1O

Synonyms:
β-D-Glucopyranoside, (3β,6α,12β)-20-(β-D-glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl 4-O-α-D-glucopyranosyl-
Notoginsenoside N
(3β,6α,12β)-20-(β-D-Glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl 4-O-α-D-glucopyranosyl-β-D-glucopyranoside