CAS 3506-32-9
:4-[2-(propan-2-ylamino)ethyl]benzene-1,2-diol
Description:
4-[2-(Propan-2-ylamino)ethyl]benzene-1,2-diol, also known by its CAS number 3506-32-9, is an organic compound characterized by its structure, which includes a benzene ring substituted with two hydroxyl groups (diol) and an isopropylamino side chain. This compound typically exhibits properties associated with both aromatic compounds and alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the hydroxyl groups. The presence of the isopropylamino group suggests that it may exhibit basic properties and could interact with biological systems, making it of interest in medicinal chemistry. Its molecular structure may also confer specific reactivity patterns, particularly in electrophilic aromatic substitution reactions. Additionally, the compound's hydroxyl groups can influence its physical properties, such as melting and boiling points, as well as its stability under various conditions. Overall, 4-[2-(propan-2-ylamino)ethyl]benzene-1,2-diol is a compound with potential applications in pharmaceuticals and biochemistry, warranting further investigation into its biological activity and chemical behavior.
Formula:C11H17NO2
InChI:InChI=1/C11H17NO2/c1-8(2)12-6-5-9-3-4-10(13)11(14)7-9/h3-4,7-8,12-14H,5-6H2,1-2H3
SMILES:CC(C)NCCc1ccc(c(c1)O)O
Synonyms:- 1,2-Benzenediol, 4-(2-((1-methylethyl)amino)ethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

