CAS 35060-08-3
:N-(2-aminoethyl)-5-(dimethylamino)naphthalene-1-sulfonamide
Description:
N-(2-aminoethyl)-5-(dimethylamino)naphthalene-1-sulfonamide, commonly referred to as a sulfonamide compound, is characterized by its naphthalene core, which is substituted with a sulfonamide group and an aminoethyl chain. This compound features a dimethylamino group, contributing to its basicity and potential for protonation under acidic conditions. The sulfonamide moiety is known for its ability to form hydrogen bonds, enhancing its solubility in polar solvents. The presence of the naphthalene structure imparts hydrophobic characteristics, which can influence its interactions in biological systems. This compound is often utilized in biochemical research, particularly in studies involving enzyme inhibition or as a fluorescent probe due to its unique electronic properties. Its molecular structure allows for various functional modifications, making it a versatile building block in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the pH of the environment, which is crucial for its application in various chemical and biological contexts.
Formula:C14H19N3O2S
InChI:InChI=1/C14H19N3O2S/c1-17(2)13-7-3-6-12-11(13)5-4-8-14(12)20(18,19)16-10-9-15/h3-8,16H,9-10,15H2,1-2H3
SMILES:CN(C)c1cccc2c1cccc2S(=O)(=O)NCCN
Synonyms:- 1-naphthalenesulfonamide, N-(2-aminoethyl)-5-(dimethylamino)-
- Monodansylethylenediamine
- N-(2-Aminoethyl)-5-(dimethylamino)-1-naphthalenesulfonamide
- N-(2-Aminoethyl)-5-(dimethylamino)naphthalene-1-sulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Dansyl Ethylenediamine
CAS:Formula:C14H19N3O2SPurity:98%Color and Shape:SolidMolecular weight:293.3846Dansyl ethylenediamine
CAS:Dansyl ethylenediamine, a fluorescent probe, is utilized in the synthesis of protein-imprinted polymers for the specific transduction of protein binding eventsFormula:C14H19N3O2SColor and Shape:SolidMolecular weight:293.39N-(2-Aminoethyl)-5-(Dimethylamino)Naphthalene-1-Sulfonamide
CAS:N-(2-Aminoethyl)-5-(Dimethylamino)Naphthalene-1-SulfonamidePurity:97%Molecular weight:293.38g/molDansyl Ethylenediamine
CAS:Controlled Product<p>Applications A fluorescent reagent.<br>References Doyle, E.L., et al.: J. Am. Chem. Soc., 125, 4593 (2003), Hwang, S., et al.: Bioorg. Med. Chem. Lett., 16, 5773 (2006),<br></p>Formula:C14H19N3O2SColor and Shape:NeatMolecular weight:293.38Dansyl ethylenediamine
CAS:Dansyl ethylenediamine is a fluorescent probe that binds to peptides containing an amino acid with a free sulfhydryl group. It is used in the study of biological samples, such as tissue culture and blood cells, for detecting amines. Dansyl ethylenediamine has been shown to bind to α1-acid glycoprotein, which is present in human plasma and increases in concentration during congestive heart failure. This compound also exhibits conformational properties that make it ideal for analytical chemistry techniques such as high performance liquid chromatography (HPLC) and gas chromatography (GC).Formula:C14H19N3O2SPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:293.39 g/mol






