CAS 35065-12-4
:3-(4-hydroxyphenoxy)benzoic acid
Description:
3-(4-Hydroxyphenoxy)benzoic acid, with the CAS number 35065-12-4, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a hydroxyphenyl ether group. This compound features a hydroxyl group (-OH) attached to a phenyl ring, which enhances its solubility in polar solvents and contributes to its potential biological activity. The presence of both the carboxylic acid group and the hydroxy group allows for hydrogen bonding, which can influence its reactivity and interactions with other molecules. It is often studied for its applications in pharmaceuticals, agrochemicals, and as a potential intermediate in organic synthesis. The compound may exhibit antioxidant properties due to the presence of the hydroxyl group, making it of interest in various fields, including medicinal chemistry and materials science. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature, which are important considerations in its practical applications.
Formula:C13H10O4
InChI:InChI=1/C13H10O4/c14-10-4-6-11(7-5-10)17-12-3-1-2-9(8-12)13(15)16/h1-8,14H,(H,15,16)
SMILES:c1cc(cc(c1)Oc1ccc(cc1)O)C(=O)O
Synonyms:- 35065-12-4
- Pyrethroid metabolite
- 3-(4-Hydroxyphenoxy)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(4'-Hydroxy)phenoxybenzoic Acid
CAS:Formula:C13H10O4Purity:95%Color and Shape:SolidMolecular weight:230.2161(4′-Hydroxy)phenoxybenzoic Acid
CAS:(4′-Hydroxy)phenoxybenzoic acid is a pyrethroid insecticide metabolite.1,2Formula:C13H10O4Color and Shape:SolidMolecular weight:230.21613-(4'-Hydroxy)phenoxybenzoic Acid
CAS:Applications A metabolite of pyrethroid insecticides such as: Deltamethrin, Permethrin, Cypermethrin, Fenvalerate, Decamethrin.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Woollen, B., et al.: Xenobiotica, 22, 983 (1992), Saito, K., et al.: Toxicol. Sci., 57, 54 (2000), Fang, H., et al.: Chem. Res. Toxicol., 14, 280 (2001), Andersen, H., et al.: Toxicol. Appl. Pharmacol., 179, 1 (2002),Formula:C13H10O4Color and Shape:NeatMolecular weight:230.22



