CAS 3507-17-3

2-bromo-6-chloro-1,3-benzothiazole

Description:

2-Bromo-6-chloro-1,3-benzothiazole is a heterocyclic compound characterized by the presence of both bromine and chlorine substituents on a benzothiazole ring system. This compound features a benzene ring fused to a thiazole ring, which contains a sulfur and nitrogen atom. The bromine and chlorine atoms are located at the 2 and 6 positions, respectively, contributing to its reactivity and potential applications in various chemical reactions. The presence of these halogens can enhance the compound's electrophilic character, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, benzothiazole derivatives are known for their biological activities, including antimicrobial and antifungal properties. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks and environmental concerns. Overall, 2-bromo-6-chloro-1,3-benzothiazole is a valuable compound in the field of medicinal chemistry and materials science.

Formula: C₇H₃BrClNS

InChI: InChI=1/C7H3BrClNS/c8-7-10-5-2-1-4(9)3-6(5)11-7/h1-3H

SMILES: c1cc2c(cc1Cl)sc(Br)n2

Synonyms:

• 2-Bromo-6-chloro-benzothiazole
• Benzothiazole, 2-Bromo-6-Chloro-

2-Bromo-6-Chloro-Benzothiazole

CAS: 3507-17-3

Formula: C₇H₃BrClNS

Purity: 97%

Color and Shape: Solid

Molecular weight: 248.5274

Ref: IN-DA00C0KF

2-bromo-6-chloro-1,3-benzothiazole

CAS: 3507-17-3

2-bromo-6-chloro-1,3-benzothiazole

Purity: 98%

Molecular weight: 248.53g/mol

Ref: 54-OR480520

2-Bromo-6-chlorobenzo[d]thiazole

CAS: 3507-17-3

Formula: C₇H₃BrClNS

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 248.52

Ref: 10-F077017