CymitQuimica logo

CAS 35071-17-1

:

2-Mercapto-4-methylpyrimidine

Description:
2-Mercapto-4-methylpyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a thiol (-SH) group at the 2-position and a methyl group at the 4-position of the pyrimidine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the thiol group imparts distinct reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and redox reactions. 2-Mercapto-4-methylpyrimidine is known for its potential applications in pharmaceuticals, agrochemicals, and as a ligand in coordination chemistry due to its ability to form complexes with metal ions. Additionally, it exhibits biological activity, which may include antimicrobial and antioxidant properties. Proper handling and storage are essential due to its potential toxicity and reactivity.
Formula:C5H6N2S
InChI:InChI=1S/C5H6N2S/c1-4-2-3-6-5(8)7-4/h2-3H,1H3,(H,6,7,8)
InChI key:InChIKey=BVPHXTUEZOQIBS-UHFFFAOYSA-N
SMILES:CC=1NC(=S)N=CC1
Synonyms:
  • 2-Mercapto-4-methylpyrimidine
  • 2-Pyrimidinethiol, 4-methyl-
  • 2-Pyrimidinethiol,4-methyl- (6CI,7CI)
  • 4-Methyl-2(1H)-pyrimidinethione
  • 4-Methyl-2-mercaptopyrimidine
  • 4-Methyl-2-pyrimidinethiol
  • 4-Methyl-2-thiopyrimidine
  • 4-Methylpyrimidine-2-thione
  • Nsc 314275
  • 2(1H)-Pyrimidinethione, 4-methyl-
Found 4 products.