
CAS 3508-98-3
:Butylphenylacetonitrile
Description:
Butylphenylacetonitrile, with the CAS number 3508-98-3, is an organic compound characterized by its structure, which includes a butyl group, a phenyl group, and a nitrile functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications. Butylphenylacetonitrile is often utilized in the synthesis of pharmaceuticals and agrochemicals, as well as in research settings for its potential biological activities. The presence of the nitrile group contributes to its reactivity, allowing for further chemical modifications. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and irritant properties. Proper storage and handling procedures are essential to minimize exposure and ensure safety in laboratory or industrial environments.
Formula:C12H15N
InChI:InChI=1S/C12H15N/c1-2-3-7-12(10-13)11-8-5-4-6-9-11/h4-6,8-9,12H,2-3,7H2,1H3
InChI key:InChIKey=OTERUZJEJFMEEB-UHFFFAOYSA-N
SMILES:C(CCCC)(C#N)C1=CC=CC=C1
Synonyms:- α-Butylbenzeneacetonitrile
- Hexanenitrile, 2-phenyl-
- α-Phenylcaprononitrile
- Benzeneacetonitrile, α-butyl-
- Butylphenylacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
