CAS 350800-81-6
:6-bromo-1H-indol-4-amine
Description:
6-Bromo-1H-indol-4-amine is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 6-position and an amino group at the 4-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. It is often used in medicinal chemistry and research, particularly in the development of pharmaceuticals, due to its potential biological activity. The bromine substituent can enhance the compound's reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 6-bromo-1H-indol-4-amine may serve as a building block for synthesizing more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H7BrN2
InChI:InChI=1/C8H7BrN2/c9-5-3-7(10)6-1-2-11-8(6)4-5/h1-4,11H,10H2
SMILES:c1c[nH]c2cc(cc(c12)N)Br
Synonyms:- 1H-indol-4-amine, 6-bromo-
- 6-Bromo-1H-indol-4-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Bromo-1H-indol-4-amine
CAS:Formula:C8H7BrN2Purity:97%Color and Shape:SolidMolecular weight:211.05864-Amino-6-bromoindole
CAS:4-Amino-6-bromoindole is a potent and selective antagonist of the 5-HT6 receptor, which is a subtype of serotonin receptor. It has been shown to bind with high affinity to this receptor in both rat and human brain tissue. 4-Amino-6-bromoindole has been synthesised by medicinal chemistry methods and has been shown to block the effects of scopolamine in animal models. 4-Amino-6-bromoindole has also shown promise as a potential treatment for schizophrenia, depression, anxiety disorders, and other psychiatric disorders.Formula:C8H7BrN2Purity:Min. 90%Molecular weight:211.06 g/mol4-Amino-6-bromoindole
CAS:4-Amino-6-bromoindole is a versatile building block that can be used as a starting material for the synthesis of complex compounds. It is suitable for use in research and development, as well as in chemical production. The compound is a reagent and speciality chemical with high quality and useful intermediate properties. This product is also an excellent reaction component and scaffold for the production of diverse organic molecules.
Formula:C8H7BrN2Molecular weight:211.07 g/mol



