
CAS 350820-07-4
:Benzenemethanol, α-[(1S)-1-(methylamino)ethyl-2,2,2-d3]-, hydrochloride, (αR)-
Description:
Benzenemethanol, α-[(1S)-1-(methylamino)ethyl-2,2,2-d3]-, hydrochloride, (αR)-, is a chemical compound characterized by its structural features and specific isotopic labeling. This compound is a derivative of benzenemethanol, where the benzene ring is substituted with a hydroxymethyl group and an α-amino group that is deuterated at specific positions, indicated by the presence of "d3." The hydrochloride form suggests that it is a salt formed with hydrochloric acid, which typically enhances its solubility in water and stability. The (αR)- designation indicates the specific stereochemistry of the chiral center, which is crucial for its biological activity and interactions. This compound may be of interest in pharmaceutical research, particularly in the study of neurotransmitter systems or as a potential therapeutic agent, given the presence of the methylamino group. Its unique isotopic labeling can also be useful in tracing studies or metabolic research. Overall, the compound's characteristics make it significant in both synthetic and medicinal chemistry contexts.
Formula:C10H12D3NO·ClH
InChI:InChI=1S/C10H15NO.ClH/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H/t8-,10-;/m0./s1/i1D3;
InChI key:InChIKey=BALXUFOVQVENIU-RLAXCEPESA-N
SMILES:[C@@H]([C@@H](NC)C([2H])([2H])[2H])(O)C1=CC=CC=C1.Cl
Synonyms:- Benzenemethanol, α-[(1S)-1-(methylamino)ethyl-2,2,2-d3]-, hydrochloride, (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


