CAS 35086-98-7

1-hydroxy-1-(4-methylphenyl)propan-2-aminium chloride

Description:

1-Hydroxy-1-(4-methylphenyl)propan-2-aminium chloride, also known by its CAS number 35086-98-7, is an organic compound that features a quaternary ammonium structure. This substance is characterized by the presence of a hydroxyl group and a propan-2-aminium moiety, which contributes to its solubility in polar solvents. The 4-methylphenyl group, a substituted aromatic ring, imparts hydrophobic characteristics, influencing the compound's overall polarity and potential interactions in biological systems. As a quaternary ammonium compound, it may exhibit surfactant properties, making it useful in various applications, including as a disinfectant or in formulations requiring antimicrobial activity. The chloride ion serves as a counterion, enhancing the compound's stability and solubility in aqueous environments. Its unique structure allows for potential applications in pharmaceuticals, particularly in drug delivery systems or as a precursor in synthetic organic chemistry. However, specific safety and handling guidelines should be followed due to the potential biological activity of quaternary ammonium compounds.

Formula: C₁₀H₁₆ClNO

InChI: InChI=1/C10H15NO.ClH/c1-7-3-5-9(6-4-7)10(12)8(2)11;/h3-6,8,10,12H,11H2,1-2H3;1H

SMILES: Cc1ccc(cc1)C(C(C)N)O.Cl

Synonyms:

• 2-Amino-1-(4-methylphenyl)propan-1-ol hydrochloride (1:1)
• Benzenemethanol, Alpha-(1-Aminoethyl)-4-Methyl-, Hydrochloride (1:1)

4-Methylnorephedrine Hydrochloride (Mixture of Diastereomers)

Controlled Product

CAS: 35086-98-7

Formula: C₁₀H₁₅NO·HCl

Color and Shape: Neat

Molecular weight: 201.693

Ref: TR-M324435

2-Amino-1-(4-methylphenyl)propan-1-ol hydrochloride

Controlled Product

CAS: 35086-98-7

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO•HCl

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 201.69 g/mol

Ref: 3D-KBA08698