CAS 35090-64-3

5-Bromo-2-hydroxy-3-methoxybenzyl alcohol

Description:

5-Bromo-2-hydroxy-3-methoxybenzyl alcohol is an organic compound characterized by its aromatic structure, which includes a bromine atom, a hydroxyl group, and a methoxy group attached to a benzyl alcohol framework. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The hydroxyl group (-OH) contributes to its polarity, enhancing its solubility in polar solvents and making it a potential candidate for various chemical reactions, such as nucleophilic substitutions or coupling reactions. The methoxy group (-OCH3) can also affect the electronic properties of the molecule, often acting as an electron-donating group that can stabilize certain reactive intermediates. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis, medicinal chemistry, and as a building block for more complex molecules. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₉BrO₃

InChI: InChI=1/C8H9BrO3/c1-12-7-3-6(9)2-5(4-10)8(7)11/h2-3,10-11H,4H2,1H3

SMILES: COc1cc(cc(CO)c1O)Br

Synonyms:

• Benzenemethanol, 5-Bromo-2-Hydroxy-3-Methoxy-
• 4-Bromo-2-(Hydroxymethyl)-6-Methoxyphenol

4-Bromo-2-(hydroxymethyl)-6-methoxyphenol

CAS: 35090-64-3

Formula: C₈H₉BrO₃

Purity: 95%

Molecular weight: 233.0593

Ref: IN-DA003KVB

4-Bromo-2-(hydroxymethyl)-6-methoxyphenol

CAS: 35090-64-3

4-Bromo-2-(hydroxymethyl)-6-methoxyphenol

Purity: tech

Molecular weight: 233.06g/mol

Ref: 54-OR32240

4-Bromo-2-(hydroxymethyl)-6-methoxyphenol

CAS: 35090-64-3

Versatile small molecule scaffold

Formula: C₈H₉BrO₃

Purity: Min. 95%

Molecular weight: 233.06 g/mol

Ref: 3D-KBA09064