CAS 350988-34-0

Methyl 2-amino-4-(4-methoxyphenyl)-3-thiophenecarboxylate

Description:

Methyl 2-amino-4-(4-methoxyphenyl)-3-thiophenecarboxylate, with the CAS number 350988-34-0, is an organic compound characterized by its complex structure, which includes a thiophene ring, an amino group, and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino and carboxylate functional groups. The methoxy group can influence its electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the thiophene moiety may contribute to its stability and aromatic character. Methyl 2-amino-4-(4-methoxyphenyl)-3-thiophenecarboxylate may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. As with many organic compounds, its behavior in various chemical environments can be influenced by factors such as pH, temperature, and the presence of other reagents.

Formula: C₁₃H₁₃NO₃S

InChI: InChI=1S/C13H13NO3S/c1-16-9-5-3-8(4-6-9)10-7-18-12(14)11(10)13(15)17-2/h3-7H,14H2,1-2H3

InChI key: InChIKey=ZGOUZQMMKJXNQQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(=CSC1N)C2=CC=C(OC)C=C2

Synonyms:

• 3-Thiophenecarboxylic acid, 2-amino-4-(4-methoxyphenyl)-, methyl ester
• Methyl 2-amino-4-(4-methoxyphenyl)-3-thiophenecarboxylate

2-Amino-4-(4-methoxy-phenyl)thiophene-3-carboxylic acid methyl ester

CAS: 350988-34-0

Formula: C₁₃H₁₃NO₃S

Purity: 95.0%

Molecular weight: 263.31

Ref: 10-F014054