CAS 350988-41-9
:3-ethoxy-4-propoxybenzaldehyde
Description:
3-Ethoxy-4-propoxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group. The presence of ethoxy and propoxy substituents on the benzene ring influences its physical and chemical properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents due to their hydrophobic alkyl chains, while being less soluble in water. The aldehyde functional group contributes to its reactivity, particularly in nucleophilic addition reactions and condensation reactions. This compound may also exhibit characteristic infrared (IR) absorption peaks associated with the aldehyde C=O stretch and the ether C-O stretches. Additionally, it may show distinct peaks in its nuclear magnetic resonance (NMR) spectrum, reflecting the unique environment of the hydrogen atoms in the ethoxy and propoxy groups. The compound's potential applications could span various fields, including organic synthesis and materials science, depending on its reactivity and functional properties. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C12H16O3
InChI:InChI=1/C12H16O3/c1-3-7-15-11-6-5-10(9-13)8-12(11)14-4-2/h5-6,8-9H,3-4,7H2,1-2H3
SMILES:CCCOc1ccc(cc1OCC)C=O
Synonyms:- Benzaldehyde, 3-ethoxy-4-propoxy-
- 3-Ethoxy-4-propoxybenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
