CAS 350988-43-1

Propyl 2-amino-4-phenyl-3-thiophenecarboxylate

Description:

Propyl 2-amino-4-phenyl-3-thiophenecarboxylate, identified by its CAS number 350988-43-1, is an organic compound that features a thiophene ring, an amino group, and an ester functional group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. The thiophene moiety contributes to its aromatic character, which can enhance stability and affect electronic properties. Additionally, the propyl ester group may influence the compound's lipophilicity, impacting its absorption and distribution in biological systems. Overall, this compound's unique structural features make it a subject of interest for research in drug development and organic synthesis, although specific applications and biological activities would require further investigation to fully understand its potential uses.

Formula: C₁₄H₁₅NO₂S

InChI: InChI=1S/C14H15NO2S/c1-2-8-17-14(16)12-11(9-18-13(12)15)10-6-4-3-5-7-10/h3-7,9H,2,8,15H2,1H3

InChI key: InChIKey=LKXQNNNAZINRAA-UHFFFAOYSA-N

SMILES: C(OCCC)(=O)C=1C(=CSC1N)C2=CC=CC=C2

Synonyms:

• 3-Thiophenecarboxylic Acid, 2-Amino-4-Phenyl-, Propyl Ester
• Propyl 2-amino-4-phenyl-3-thiophenecarboxylate

propyl 2-amino-4-phenylthiophene-3-carboxylate

CAS: 350988-43-1

Formula: C₁₄H₁₅NO₂S

Purity: 95.0%

Molecular weight: 261.34

Ref: 10-F307169