CAS 350990-15-7

methyl 2-amino-4-[4-(1-methylpropyl)phenyl]thiophene-3-carboxylate

Description:

Methyl 2-amino-4-[4-(1-methylpropyl)phenyl]thiophene-3-carboxylate, identified by its CAS number 350990-15-7, is a chemical compound that features a thiophene ring, which is a five-membered heterocyclic structure containing sulfur. This compound exhibits characteristics typical of both aromatic and aliphatic systems due to its structural components, including an amino group and a carboxylate ester. The presence of the methylpropyl substituent on the phenyl ring contributes to its hydrophobic properties, potentially influencing its solubility and reactivity. The amino group can participate in hydrogen bonding, making the compound potentially useful in various biological applications, including as a pharmaceutical intermediate. Additionally, the thiophene moiety is known for its electronic properties, which can be advantageous in organic electronics and materials science. Overall, this compound's unique structure may confer specific biological activities and chemical reactivity, making it of interest in medicinal chemistry and material development.

Formula: C₁₆H₁₉NO₂S

InChI: InChI=1/C16H19NO2S/c1-4-10(2)11-5-7-12(8-6-11)13-9-20-15(17)14(13)16(18)19-3/h5-10H,4,17H2,1-3H3

SMILES: CCC(C)c1ccc(cc1)c1csc(c1C(=O)OC)N

Synonyms:

• 3-Thiophenecarboxylic Acid, 2-Amino-4-[4-(1-Methylpropyl)Phenyl]-, Methyl Ester
• Methyl 2-amino-4-(4-sec-butylphenyl)thiophene-3-carboxylate

methyl 2-amino-4-(4-sec-butylphenyl)thiophene-3-carboxylate

CAS: 350990-15-7

Formula: C₁₆H₁₉NO₂S

Purity: 95.0%

Molecular weight: 289.39

Ref: 10-F307163