CAS 350997-06-7

1-Methylethyl 5-amino-4-cyano-3-methyl-2-thiophenecarboxylate

Description:

1-Methylethyl 5-amino-4-cyano-3-methyl-2-thiophenecarboxylate, with the CAS number 350997-06-7, is a chemical compound that features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound is characterized by the presence of various functional groups, including an amino group, a cyano group, and an ester group, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the methyl and ethyl substituents indicates that it has branched alkyl groups, which can influence its solubility and interaction with biological systems. The thiophene moiety often imparts unique electronic properties, making such compounds of interest in materials science and pharmaceuticals. Additionally, the specific arrangement of substituents can affect the compound's biological activity, making it a candidate for further research in drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical applications.

Formula: C₁₀H₁₂N₂O₂S

InChI: InChI=1S/C10H12N2O2S/c1-5(2)14-10(13)8-6(3)7(4-11)9(12)15-8/h5H,12H2,1-3H3

InChI key: InChIKey=GEANAYPMVNELBY-UHFFFAOYSA-N

SMILES: C(OC(C)C)(=O)C1=C(C)C(C#N)=C(N)S1

Synonyms:

• 1-Methylethyl 5-amino-4-cyano-3-methyl-2-thiophenecarboxylate
• 2-Thiophenecarboxylic Acid, 5-Amino-4-Cyano-3-Methyl-, 1-Methylethyl Ester
• Isopropyl 5-amino-4-cyano-3-methylthiophene-2-carboxylate

isopropyl 5-amino-4-cyano-3-methylthiophene-2-carboxylate

CAS: 350997-06-7

Formula: C₁₀H₁₂N₂O₂S

Purity: 95.0%

Molecular weight: 224.28

Ref: 10-F307159