CAS 351-70-2
:benzyl trifluoroacetate
Description:
Benzyl trifluoroacetate is an organic compound characterized by its ester functional group, formed from the reaction of benzyl alcohol and trifluoroacetic acid. It typically appears as a colorless to pale yellow liquid with a distinctive sweet, fruity odor. The presence of trifluoroacetate imparts unique properties, including increased lipophilicity and stability under various conditions. This compound is known for its utility in organic synthesis, particularly in the preparation of fluorinated compounds and as a reagent in various chemical reactions. It is moderately soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic benzyl group. Benzyl trifluoroacetate is also recognized for its potential applications in pharmaceuticals and agrochemicals, where the trifluoromethyl group can enhance biological activity. As with many chemical substances, proper handling and safety precautions are essential, as it may pose health risks if ingested or inhaled.
Formula:C9H7F3O2
InChI:InChI=1/C9H7F3O2/c10-9(11,12)8(13)14-6-7-4-2-1-3-5-7/h1-5H,6H2
SMILES:c1ccc(cc1)COC(=O)C(F)(F)F
Synonyms:- Acetic Acid, 2,2,2-Trifluoro-, Phenylmethyl Ester
- Acetic acid, trifluoro-, benzyl ester
- Acetic acid, trifluoro-, phenylmethyl ester
- Benzyl trifluoroacetate
- Phenylmethyl 2,2,2-trifluoroacetate
- Benzyl 2,2,2-trifluoroacetate
- Trifluoroacetic acid benzyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Phenylmethyl 2,2,2-trifluoroacetate
CAS:Phenylmethyl 2,2,2-trifluoroacetate
Molecular weight:204.14589g/molBenzyl trifluoroacetate
CAS:Formula:C9H7F3O2Color and Shape:Liquid, Clear LiquidMolecular weight:204.148


