CAS 3510-48-3

bis(4-chlorobenzylidene)hydrazine

Description:

Bis(4-chlorobenzylidene)hydrazine is an organic compound characterized by its hydrazine backbone with two 4-chlorobenzylidene groups attached. It typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and as a ligand in coordination chemistry. The presence of the 4-chlorobenzylidene moieties contributes to its stability and reactivity, making it useful in various chemical reactions, including condensation and coupling reactions. The compound exhibits notable properties such as moderate solubility in organic solvents and a tendency to form complexes with metal ions. Its structure includes a hydrazine (-NH-NH-) functional group, which is significant in biological and chemical processes. Additionally, the chlorinated aromatic rings can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions with other substances. Safety precautions should be observed when handling this compound, as it may pose health risks, including toxicity and irritant effects.

Formula: C₁₄H₁₀Cl₂N₂

InChI: InChI=1/C14H10Cl2N2/c15-13-5-1-11(2-6-13)9-17-18-10-12-3-7-14(16)8-4-12/h1-10H

SMILES: c1cc(ccc1C=NN=Cc1ccc(cc1)Cl)Cl

N,N'-Bis(4-chlorobenzylidene)hydrazine

CAS: 3510-48-3

N,N'-Bis(4-chlorobenzylidene)hydrazine is an organic nitrogen compound that is used as a reagent in organic chemistry. It can be used to synthesize hydrazones, toluenes, and carbonyls. This reagent also has the ability to catalyze olefinations. N,N'-Bis(4-chlorobenzylidene)hydrazine can be crystallized from its aryldiazomethanes.

Formula: C₁₄H₁₀Cl₂N₂

Purity: Min. 95%

Molecular weight: 277.15 g/mol

Ref: 3D-IB57824