CAS 35100-44-8
:(6α,11β)-11-Hydroxy-6-methylpregna-1,4-diene-3,20-dione
Description:
The chemical substance known as (6α,11β)-11-Hydroxy-6-methylpregna-1,4-diene-3,20-dione, with the CAS number 35100-44-8, is a synthetic steroid that belongs to the class of glucocorticoids. It is characterized by its steroidal structure, which includes a cyclopentanoperhydrophenanthrene core, and features hydroxyl groups at specific positions that contribute to its biological activity. This compound exhibits anti-inflammatory and immunosuppressive properties, making it relevant in medical applications, particularly in the treatment of various inflammatory and autoimmune conditions. Its mechanism of action typically involves the modulation of gene expression through interaction with glucocorticoid receptors, leading to a reduction in the production of pro-inflammatory cytokines. Additionally, the presence of the methyl group and hydroxyl groups in its structure influences its pharmacokinetics and potency. As with many steroids, it is essential to consider its potential side effects and the importance of dosage regulation in therapeutic contexts.
Formula:C22H30O3
InChI:InChI=1/C22H30O3/c1-12-9-15-17-6-5-16(13(2)23)22(17,4)11-19(25)20(15)21(3)8-7-14(24)10-18(12)21/h7-8,10,12,15-17,19-20,25H,5-6,9,11H2,1-4H3/t12-,15-,16+,17-,19-,20+,21-,22+/m0/s1
InChI key:InChIKey=VDNZZIYSCXESNI-ILSZZQPISA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(C[C@@H]3O)[C@@H](C(C)=O)CC4)[H])(C[C@H](C)C1=CC(=O)C=C2)[H])[H]
Synonyms:- (6Alpha,11Beta)-11-Hydroxy-6-Methylpregna-1,4-Diene-3,20-Dione
- (6α,11β)-11-Hydroxy-6-methylpregna-1,4-diene-3,20-dione
- 11beta-Hydroxy-6alpha-methylpregna-1,4-diene-3,20-dione
- Endrisona
- Endrisona [INN-Spanish]
- Endrisona [Spanish]
- Endrisonum
- Endrisonum [INN-Latin]
- Endrysone
- Endrysone [USAN]
- Pregna-1,4-diene-3,20-dione, 11-hydroxy-6-methyl-, (6alpha,11beta)-
- Pregna-1,4-diene-3,20-dione, 11-hydroxy-6-methyl-, (6α,11β)-
- Pregna-1,4-diene-3,20-dione, 11β-hydroxy-6α-methyl-
- Unii-1Qz096Eief
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
