CAS 351002-78-3
:1-(tert-butoxycarbonyl)-2-(4-fluorobenzyl)proline
Description:
1-(tert-Butoxycarbonyl)-2-(4-fluorobenzyl)proline, with the CAS number 351002-78-3, is a chemical compound that belongs to the class of amino acids, specifically a proline derivative. This compound features a tert-butoxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect the amino group from unwanted reactions. The presence of a 4-fluorobenzyl group indicates that it has a fluorinated aromatic substituent, which can influence its biological activity and solubility. The proline structure contributes to its potential role in peptide synthesis and drug development, as proline is known for its unique conformational properties in peptides. The compound is typically characterized by its molecular weight, solubility in organic solvents, and stability under various conditions. Its synthesis and application are of interest in medicinal chemistry, particularly in the design of bioactive molecules. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines.
Formula:C17H22FNO4
InChI:InChI=1/C17H22FNO4/c1-16(2,3)23-15(22)19-10-4-9-17(19,14(20)21)11-12-5-7-13(18)8-6-12/h5-8H,4,9-11H2,1-3H3,(H,20,21)
SMILES:CC(C)(C)OC(=O)N1CCCC1(Cc1ccc(cc1)F)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
