CAS 351003-02-6

5-Bromo-2-methyl-3-pyridinecarboxylic acid

Description:

5-Bromo-2-methyl-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 2-position of the pyridine ring contributes to its unique chemical properties. This compound features a carboxylic acid functional group at the 3-position, which imparts acidic characteristics and enhances its solubility in polar solvents. The molecular structure allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. 5-Bromo-2-methyl-3-pyridinecarboxylic acid is often utilized in pharmaceutical research and synthesis due to its ability to serve as a building block for more complex molecules. Its bromine substituent can also facilitate various chemical reactions, such as nucleophilic substitutions. Overall, this compound exhibits a combination of aromaticity, acidity, and reactivity that makes it valuable in organic synthesis and medicinal chemistry.

Formula: C₇H₆BrNO₂

InChI: InChI=1S/C7H6BrNO2/c1-4-6(7(10)11)2-5(8)3-9-4/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=WOVLKYARFQYAMN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C)N=CC(Br)=C1

Synonyms:

• 3-Pyridinecarboxylic acid, 5-bromo-2-methyl-
• 5-Bromo-2-Methylpyridine-3-Carboxylic Acid
• 5-Bromo-2-methyl-3-pyridinecarboxylic acid
• Cl0346
• 5-Bromo-2-methylnicotinic acid

5-Bromo-2-methylpyridine-3-carboxylic acid

CAS: 351003-02-6

Formula: C₇H₆BrNO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 216.0320

Ref: IN-DA003819

5-Bromo-2-methylnicotinic acid

CAS: 351003-02-6

5-Bromo-2-methylnicotinic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 216.03g/mol

Ref: 54-OR959451

5-Bromo-2-methylnicotinic acid

CAS: 351003-02-6

Formula: C₇H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 216.034

Ref: 10-F220441