CAS 351003-21-9

2-Bromo-4-fluoro-1-(trifluoromethyl)benzene

Description:

2-Bromo-4-fluoro-1-(trifluoromethyl)benzene, with the CAS number 351003-21-9, is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, and a trifluoromethyl group attached to a benzene ring. This compound exhibits a molecular structure that contributes to its unique chemical properties, including its reactivity and stability. The presence of multiple halogen substituents typically enhances the compound's lipophilicity and can influence its behavior in various chemical reactions, such as electrophilic aromatic substitution. Additionally, the trifluoromethyl group is known for imparting significant electronic effects, often making the compound more resistant to degradation. 2-Bromo-4-fluoro-1-(trifluoromethyl)benzene may be utilized in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its potential as an intermediate in organic synthesis. Its physical properties, such as boiling point and solubility, are influenced by the halogen substituents, which can also affect its interactions with biological systems and environmental behavior.

Formula: C₇H₃BrF₄

InChI: InChI=1S/C7H3BrF4/c8-6-3-4(9)1-2-5(6)7(10,11)12/h1-3H

InChI key: InChIKey=XBBGYSIEJHXPLL-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Br)C=C(F)C=C1

Synonyms:

• 1-Bromo-2-trifluoromethyl-5-fluorobenzene
• 2-Bromo-4-fluoro-1-(trifluoromethyl)benzene
• 2-Bromo-4-fluoro-1-trifluoromethylbenzene
• 4-Fluoro-2-bromobenzotrifluoride
• Benzene, 2-bromo-4-fluoro-1-(trifluoromethyl)-

2-Bromo-4-fluorobenzotrifluoride

CAS: 351003-21-9

Formula: C₇H₃BrF₄

Purity: >98.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 243.00

Ref: 3B-B3397

2-BROMO-4-FLUOROBENZOTRIFLUORIDE

CAS: 351003-21-9

Formula: C₇H₃BrF₄

Purity: 97%

Color and Shape: Liquid

Molecular weight: 242.9963

Ref: IN-DA003GO9

2-Bromo-4-fluorobenzotrifluoride

CAS: 351003-21-9

2-Bromo-4-fluorobenzotrifluoride

Formula: C₇H₃BrF₄

Purity: ≥95%

Color and Shape: Colourless Liquid

Molecular weight: 243.00g/mol

Ref: 54-PC9396

2-Bromo-4-fluorobenzotrifluoride

CAS: 351003-21-9

Formula: C₇H₃BrF₄

Purity: 97%

Color and Shape: Liquid

Molecular weight: 242.999

Ref: 10-F021893