CymitQuimica logo

CAS 351003-28-6

:

(3-Amino-6-nitro-2-benzofuranyl)(4-chlorophenyl)methanone

Description:
(3-Amino-6-nitro-2-benzofuranyl)(4-chlorophenyl)methanone, identified by its CAS number 351003-28-6, is a synthetic organic compound characterized by its complex structure, which includes a benzofuran moiety and a chlorophenyl group. This compound features an amino group and a nitro group, which contribute to its reactivity and potential biological activity. The presence of the nitro group often indicates potential for use in medicinal chemistry, as nitro compounds can exhibit various pharmacological properties. The chlorophenyl substituent may enhance lipophilicity, influencing the compound's solubility and permeability. Additionally, the compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including chromatography and spectroscopy for purity and structural confirmation. As with many synthetic compounds, safety and handling precautions are essential due to the presence of potentially hazardous functional groups. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research.
Formula:C15H9ClN2O4
InChI:InChI=1S/C15H9ClN2O4/c16-9-3-1-8(2-4-9)14(19)15-13(17)11-6-5-10(18(20)21)7-12(11)22-15/h1-7H,17H2
InChI key:InChIKey=DDGLTLBWGQVJNN-UHFFFAOYSA-N
SMILES:NC=1C=2C(OC1C(=O)C3=CC=C(Cl)C=C3)=CC(N(=O)=O)=CC2
Synonyms:
  • (3-Amino-6-nitro-2-benzofuranyl)(4-chlorophenyl)methanone
  • Methanone, (3-amino-6-nitro-2-benzofuranyl)(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.