CAS 351003-45-7
:2-Bromo-4-fluorobenzenesulfonyl chloride
Description:
2-Bromo-4-fluorobenzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that is further substituted with bromine and fluorine atoms. This compound typically appears as a solid or liquid, depending on temperature and purity, and is known for its reactivity due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The presence of the bromine and fluorine substituents can influence its chemical behavior, including its electrophilicity and solubility in various solvents. It is often used in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. Safety precautions are essential when handling this compound, as it can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Proper storage in a cool, dry place, away from moisture and incompatible substances, is also recommended to maintain its stability and reactivity.
Formula:C12H14O3
InChI:InChI=1/C12H14O3/c1-2-14-12(13)11-8-7-9-5-3-4-6-10(9)15-11/h3-6,11H,2,7-8H2,1H3
SMILES:CCOC(=O)C1CCc2ccccc2O1
Synonyms:- 2-Bromo-4-fluoro-benzenesulfonylchloride
- 2-Bromo-4-fluorobenzenesulphonyl chloride
- Wsgr Df Be
- ethyl 3,4-dihydro-2H-chromene-2-carboxylate
- 4-Fluoro-2-bromobenzenesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-4-fluorobenzenesulfonyl chloride, 97%
CAS:2-Bromo-4-fluorobenzenesulfonyl chloride is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item co
Formula:C6H3BrClFO2SPurity:97%Color and Shape:Colorless to pale cream to pale yellow, Fused solid or clear liquid as meltMolecular weight:273.502-Bromo-4-fluorobenzene-1-sulfonyl chloride
CAS:Formula:C6H3BrClFO2SPurity:97%Color and Shape:SolidMolecular weight:273.50722-Bromo-4-fluorobenzenesulphonyl chloride
CAS:2-Bromo-4-fluorobenzenesulphonyl chlorideFormula:C6H3BrClFO2SPurity:98%Color and Shape: faint to light beige fused solidMolecular weight:273.51g/mol2-Bromo-4-fluorobenzenesulfonyl chloride
CAS:Formula:C6H3BrClFO2SPurity:97%Color and Shape:Solid, Low Melting SolidMolecular weight:273.5



