CymitQuimica logo

CAS 351003-48-0

:

3-Chloro-2-fluorobenzenesulfonyl chloride

Description:
3-Chloro-2-fluorobenzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that is further substituted with chlorine and fluorine atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The presence of both chlorine and fluorine substituents on the benzene ring can influence its chemical behavior, making it useful in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals. Additionally, this compound is likely to be sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Proper safety measures, including the use of personal protective equipment, are essential when working with this substance due to its potential hazards.
Formula:C6H3Cl2FO2S
InChI:InChI=1S/C6H3Cl2FO2S/c7-4-2-1-3-5(6(4)9)12(8,10)11/h1-3H
InChI key:InChIKey=LIRQNYQIFFLGIE-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(F)C(Cl)=CC=C1
Synonyms:
  • 3-Chloro-2-fluorobenzene-1-sulfonyl chloride
  • 3-Chloro-2-fluorobenzenesulphonyl chloride
  • Benzenesulfonyl chloride, 3-chloro-2-fluoro-
  • Wsgr Cg Bf
  • 3-Chloro-2-fluorobenzenesulfonyl chloride
Found 5 products.