CAS 351003-52-6
:4-Bromo-2-chlorobenzenesulfonyl chloride
Description:
4-Bromo-2-chlorobenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a benzene ring substituted with both a bromine and a chlorine atom, contributing to its unique reactivity and properties. The presence of the sulfonyl chloride group makes it a useful intermediate in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. It is typically a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and storage. The compound is soluble in organic solvents, which facilitates its use in various chemical reactions. Additionally, it may undergo hydrolysis in the presence of moisture, leading to the formation of corresponding sulfonic acids. As with many halogenated compounds, it may also pose environmental and health risks, emphasizing the importance of proper safety measures during its use in laboratory and industrial settings.
Formula:C6H3BrCl2O2S
InChI:InChI=1/C6H3BrCl2O2S/c7-4-1-2-6(5(8)3-4)12(9,10)11/h1-3H
SMILES:c1cc(c(cc1Br)Cl)S(=O)(=O)Cl
Synonyms:- 4-Bromo-2-chlorobenzenesulphonylchloride
- Benzenesulfonyl chloride, 4-bromo-2-chloro-
- 4-Bromo-2-chlorobenzenesulphonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-2-chlorobenzenesulfonyl chloride, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3BrCl2O2SPurity:96%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:289.954-Bromo-2-chlorobenzene-1-sulfonyl chloride
CAS:Formula:C6H3BrCl2O2SPurity:98%Color and Shape:SolidMolecular weight:289.96184-Bromo-2-chlorobenzenesulphonyl chloride
CAS:4-Bromo-2-chlorobenzenesulphonyl chlorideFormula:C6H3BrCl2O2SPurity:94%Color and Shape: faint brown to light brown powderMolecular weight:289.96182g/mol4-Bromo-2-chlorobenzenesulfonyl chloride
CAS:Formula:C6H3BrCl2O2SPurity:96%Color and Shape:SolidMolecular weight:289.95



