CAS 351003-57-1

5-Chloro-2-fluorobenzenesulfonamide

Description:

5-Chloro-2-fluorobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring that is substituted with both chlorine and fluorine atoms. The compound features a chlorinated aromatic system, which contributes to its chemical stability and potential reactivity. The sulfonamide group (-SO2NH2) is known for its ability to form hydrogen bonds, influencing the compound's solubility and interaction with biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group. Its unique substitution pattern can impart specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the presence of halogens (chlorine and fluorine) can enhance lipophilicity and influence the compound's biological activity. Safety and handling precautions should be observed, as with many sulfonamide derivatives, due to potential toxicity and environmental impact.

Formula: C₆H₅ClFNO₂S

InChI: InChI=1S/C6H5ClFNO2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H,(H2,9,10,11)

InChI key: InChIKey=DBJNLJWQSQOBJM-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(F)C=CC(Cl)=C1

Synonyms:

• Benzenesulfonamide, 5-chloro-2-fluoro-
• 5-Chloro-2-fluorobenzenesulfonamide

5-Chloro-2-fluorobenzenesulfonamide

CAS: 351003-57-1

Formula: C₆H₅ClFNO₂S

Purity: 99%

Color and Shape: Solid

Molecular weight: 209.6258

Ref: IN-DA003MME

5-Chloro-2-fluorobenzenesulphonamide

CAS: 351003-57-1

5-Chloro-2-fluorobenzenesulphonamide

Formula: C₆H₅ClFNO₂S

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 209.63g/mol

Ref: 54-PC5415

5-Chloro-2-fluorobenzenesulfonamide

CAS: 351003-57-1

Formula: C₆H₅ClFNO₂S

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 209.62

Ref: 10-F034643