CAS 351003-61-7

2-bromo-5-(trifluoromethyl)benzenesulfonamide

Description:

2-Bromo-5-(trifluoromethyl)benzenesulfonamide is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to a benzene ring, which is further substituted with a sulfonamide functional group. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, including potential solubility in polar solvents and reactivity in nucleophilic substitution reactions. The trifluoromethyl group contributes to its lipophilicity and can enhance biological activity, making it of interest in medicinal chemistry. The sulfonamide moiety is known for its ability to form hydrogen bonds, which can influence the compound's interactions with biological targets. Additionally, the presence of the bromine atom may provide opportunities for further chemical modifications. Overall, 2-bromo-5-(trifluoromethyl)benzenesulfonamide is a compound of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features and potential applications.

Formula: C₇H₅BrF₃NO₂S

InChI: InChI=1/C7H5BrF3NO2S/c8-5-2-1-4(7(9,10)11)3-6(5)15(12,13)14/h1-3H,(H2,12,13,14)

SMILES: c1cc(c(cc1C(F)(F)F)S(=O)(=O)N)Br

Synonyms:

• Benzenesulfonamide, 2-bromo-5-(trifluoromethyl)-

2-Bromo-5-(trifluoromethyl)benzenesulphonamide

CAS: 351003-61-7

2-Bromo-5-(trifluoromethyl)benzenesulphonamide

Formula: C₇H₅BrF₃NO₂S

Purity: ≥95%

Color and Shape: solid

Molecular weight: 304.08g/mol

Ref: 54-PC5411