CAS 351019-18-6
:6-Fluoropyridine-3-boronic acid
Description:
6-Fluoropyridine-3-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is substituted with a fluorine atom. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in polar solvents such as water and alcohols, which is a common trait for boronic acids due to their ability to form hydrogen bonds. The presence of the fluorine atom can influence the electronic properties of the pyridine ring, potentially enhancing its reactivity in various chemical reactions, including Suzuki coupling reactions, which are widely used in organic synthesis for forming carbon-carbon bonds. Additionally, the boronic acid group allows for the formation of reversible complexes with diols, making it useful in applications such as drug delivery and sensor development. Overall, 6-Fluoropyridine-3-boronic acid is a valuable compound in medicinal chemistry and materials science due to its unique structural features and reactivity.
Formula:C5H5BFNO2
InChI:InChI=1/C5H5BFNO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3,9-10H
SMILES:c1cc(B(O)O)nc(c1)F
Synonyms:- 2-Fluoropyridine-5-boronic acid
- 2-Fluoro-5-Pyridineboronic acid
- (6-Fluoropyridin-3-Yl)Boronic Acid
- (6-Fluoropyridin-2-Yl)Boronic Acid
- 2-Fluoropyridin-5-Ylboronic Acid
- 6-Fluoropyridin-3-Ylboronic Acid
- 2-Fluoro-5-pyridylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Fluoropyridine-5-boronic acid
CAS:Formula:C5H5BFNO2Purity:97.0%Color and Shape:Solid, CrystallineMolecular weight:140.912-Fluoropyridine-5-boronic acid
CAS:Formula:C5H5BFNO2Purity:97%Color and Shape:SolidMolecular weight:140.90816-Fluoropyridine-3-boronic acid
CAS:6-Fluoropyridine-3-boronic acidFormula:C5H5BFNO2Purity:≥95%Color and Shape: white powderMolecular weight:140.91g/mol2-Fluoropyridine-5-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H5BFNO2Purity:98.0 to 115.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:140.91





