CAS 35110-20-4: Diosmetin 7-O-β-D-glucuronide
Description:Diosmetin 7-O-β-D-glucuronide is a flavonoid glycoside, a derivative of diosmetin, which is known for its antioxidant and anti-inflammatory properties. This compound features a glucuronic acid moiety attached to the 7-position of the diosmetin structure, enhancing its solubility and bioavailability. It is primarily found in various plants, particularly in citrus fruits, and is often studied for its potential health benefits, including its role in modulating oxidative stress and inflammation. Diosmetin 7-O-β-D-glucuronide exhibits various biological activities, such as anti-cancer effects and the ability to protect against cardiovascular diseases. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are influenced by its glycosylation, which can affect its interaction with biological systems. Research continues to explore its therapeutic potential and mechanisms of action, making it a compound of interest in the fields of pharmacology and nutrition.
Formula:C22H20O12
InChI:InChI=1S/C22H20O12/c1-31-13-3-2-8(4-10(13)23)14-7-12(25)16-11(24)5-9(6-15(16)33-14)32-22-19(28)17(26)18(27)20(34-22)21(29)30/h2-7,17-20,22-24,26-28H,1H3,(H,29,30)/t17-,18-,19+,20-,22+/m0/s1
InChI key:InChIKey=XCKMDTYMOHXUHG-SXFAUFNYSA-N
SMILES:O=C(O)C1OC(OC2=CC(O)=C3C(=O)C=C(OC3=C2)C=4C=CC(OC)=C(O)C4)C(O)C(O)C1O
- Synonyms:
- β-D-Glucopyranosiduronic acid, 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-1-benzopyran-7-yl
- Diosmetin 7-O-β-D-glucuronide
- Diosmetin 7-glucuronide
- 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranosiduronic acid
- Diosmetin 7-O-glucuronide
