CAS 35112-05-1

4-Chloro-2-fluoro-5-nitrobenzoic acid

Description:

4-Chloro-2-fluoro-5-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a chlorine atom, a fluorine atom, and a nitro group at specific positions on the benzene ring. The molecular structure features a carboxylic acid functional group (-COOH), which imparts acidic properties to the compound. This substance is typically a solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of electronegative substituents like chlorine and fluorine can influence the compound's reactivity, solubility, and overall chemical behavior. Additionally, the nitro group contributes to the compound's electron-withdrawing characteristics, which can affect its reactivity in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity. Proper storage and disposal methods are essential to ensure safety and environmental protection.

Formula: C₇H₂ClFNO₄

InChI: InChI=1/C7H3ClFNO4/c8-4-2-5(9)3(7(11)12)1-6(4)10(13)14/h1-2H,(H,11,12)/p-1

SMILES: c1c(c(cc(c1N(=O)=O)Cl)F)C(=O)[O-]

Synonyms:

• 4-Chloro-2-Fluoro-5-Nitrobenzoate

4-Chloro-2-Fluoro-5-Nitrobenzoic Acid

CAS: 35112-05-1

Formula: C₇H₃ClFNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.5544

Ref: IN-DA0033Z5

4-Chloro-2-fluoro-5-nitrobenzoic acid

CAS: 35112-05-1

4-Chloro-2-fluoro-5-nitrobenzoic acid

Formula: C₇H₃ClFNO₄

Purity: 98%

Color and Shape: white powder

Molecular weight: 219.55g/mol

Ref: 54-PC1692

4-Chloro-2-fluoro-5-nitrobenzoic acid

CAS: 35112-05-1

Formula: C₇H₃ClFNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.55

Ref: 10-F233663

4-chloro-2-fluoro-5-nitrobenzoic Acid

CAS: 35112-05-1

4-chloro-2-fluoro-5-nitrobenzoic acid (4C6FNA) is a synthetic compound that has been shown to inhibit the growth of Leishmania at concentrations of 5 μM. 4C6FNA binds to the DNA of replicons in the human osteoblast cell line and inhibits viral replication, including HIV and influenza. 4C6FNA also inhibits hepatitis B virus and nitric oxide production in human hepatoma cells. The synthesis of 4C6FNA was achieved through solid phase chemistry on an amide resin. This compound can be immobilized on an amine support by covalent attachment or ionic binding. The nucleophilic nature of this compound makes it suitable for use as a catalyst for organic reactions, such as esterification, amidation, or transesterification.

Formula: C₇H₃ClFNO₄

Purity: Min. 95%

Molecular weight: 219.55 g/mol

Ref: 3D-FC105577