CymitQuimica logo

CAS 351158-31-1

:

2-(2-Ethoxyphenyl)-4-quinolinecarboxylic acid

Description:
2-(2-Ethoxyphenyl)-4-quinolinecarboxylic acid, identified by its CAS number 351158-31-1, is a chemical compound that features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. This compound exhibits characteristics typical of both aromatic and heterocyclic compounds, including potential for π-π stacking interactions due to its planar structure. The presence of the ethoxyphenyl group enhances its lipophilicity, which may influence its solubility and biological activity. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its reactivity, stability, and biological effects would be necessary to fully understand its potential uses and safety profile.
Formula:C18H15NO3
InChI:InChI=1S/C18H15NO3/c1-2-22-17-10-6-4-8-13(17)16-11-14(18(20)21)12-7-3-5-9-15(12)19-16/h3-11H,2H2,1H3,(H,20,21)
InChI key:InChIKey=HKAYEAHVDMGFMR-UHFFFAOYSA-N
SMILES:O(CC)C1=C(C2=NC3=C(C(C(O)=O)=C2)C=CC=C3)C=CC=C1
Synonyms:
  • 4-Quinolinecarboxylic acid, 2-(2-ethoxyphenyl)-
  • 2-(2-Ethoxyphenyl)-4-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.