CAS 351158-36-6

methyl 2-amino-4-(4-ethoxyphenyl)-5-methylthiophene-3-carboxylate

Description:

Methyl 2-amino-4-(4-ethoxyphenyl)-5-methylthiophene-3-carboxylate, with the CAS number 351158-36-6, is a chemical compound that belongs to the class of thiophene derivatives. This substance features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributing to its unique electronic properties. The presence of an amino group and an ethoxyphenyl substituent enhances its potential for biological activity, making it of interest in medicinal chemistry. The methyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may exhibit different reactivity and solubility characteristics. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, its molecular configuration may influence its solubility, stability, and interaction with biological targets. Overall, this compound exemplifies the diverse chemistry of thiophene derivatives and their potential utility in various chemical and biological applications.

Formula: C₁₅H₁₇NO₃S

InChI: InChI=1/C15H17NO3S/c1-4-19-11-7-5-10(6-8-11)12-9(2)20-14(16)13(12)15(17)18-3/h5-8H,4,16H2,1-3H3

SMILES: CCOc1ccc(cc1)c1c(C)sc(c1C(=O)OC)N

Synonyms:

• 3-Thiophenecarboxylic Acid, 2-Amino-4-(4-Ethoxyphenyl)-5-Methyl-, Methyl Ester

Methyl 2-amino-4-(4-ethoxyphenyl)-5-methylthiophene-3-carboxylate

CAS: 351158-36-6

Formula: C₁₅H₁₇NO₃S

Molecular weight: 291.3654

Ref: IN-DA00C8BA

methyl 2-amino-4-(4-ethoxyphenyl)-5-methylthiophene-3-carboxylate

CAS: 351158-36-6

Formula: C₁₅H₁₇NO₃S

Purity: 95.0%

Molecular weight: 291.37

Ref: 10-F307639