CAS 351184-42-4

9H-fluoren-9-ylmethyl 4-hydroxypiperidine-1-carboxylate

Description:

9H-fluoren-9-ylmethyl 4-hydroxypiperidine-1-carboxylate, with the CAS number 351184-42-4, is a chemical compound characterized by its unique structural features. It consists of a fluorenylmethyl group attached to a piperidine ring that contains a hydroxyl group and a carboxylate moiety. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific conditions. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Additionally, the fluorenyl group contributes to its aromatic characteristics, potentially affecting its electronic properties and stability. This compound may be of interest in medicinal chemistry and drug development due to its structural motifs, which can be relevant in the design of pharmacologically active agents. As with many organic compounds, its behavior in biological systems would depend on various factors, including its stereochemistry and functional group interactions.

Formula: C₂₀H₂₁NO₃

InChI: InChI=1/C20H21NO3/c22-14-9-11-21(12-10-14)20(23)24-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,14,19,22H,9-13H2

SMILES: c1ccc2c(c1)c1ccccc1C2COC(=O)N1CCC(CC1)O

N-FMOC-4-PIPERIDINOL

CAS: 351184-42-4

Formula: C₂₀H₂₁NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 323.3856

Ref: IN-DA00BYYF

(9H-Fluoren-9-yl)methyl 4-hydroxypiperidine-1-carboxylate

CAS: 351184-42-4

(9H-Fluoren-9-yl)methyl 4-hydroxypiperidine-1-carboxylate

Purity: 95%

Molecular weight: 323.39g/mol

Ref: 54-OR93704

(9H-Fluoren-9-yl)methyl 4-hydroxypiperidine-1-carboxylate

CAS: 351184-42-4

Formula: C₂₀H₂₁NO₃

Purity: 97%

Molecular weight: 323.392

Ref: 10-F547165

9H-Fluoren-9-ylmethyl 4-hydroxypiperidine-1-carboxylate

CAS: 351184-42-4

9H-Fluoren-9-ylmethyl 4-hydroxypiperidine-1-carboxylate (Fmoc) is a primary alcohol that has been used extensively as a building block in the synthesis of cyclic peptides. Fmoc is often irradiated with microwaves to convert it into an activated form that can be coupled with other amino acids. The hydroxyl group on Fmoc can be used to synthesize hydroxylated molecules, such as 1,2,3,4-tetrahydroquinoline and 4-(chloromethyl)piperidine. This reagent has also been used for the synthesis of cyclic peptides by immobilization on resin beads. It is toxic at high doses and should be handled with care.

Formula: C₂₀H₂₁NO₃

Purity: Min. 95%

Molecular weight: 323.4 g/mol

Ref: 3D-BPA18442