CymitQuimica logo

CAS 35123-06-9

:

N,N-Dimethyllactamide

Description:
N,N-Dimethyllactamide is an organic compound characterized by its amide functional group, specifically derived from lactic acid. It features a dimethyl substitution on the nitrogen atom, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid with a mild odor. It is known for its high polarity, which enhances its solubility in polar solvents such as water and alcohols, making it useful in various applications, including as a solvent and in chemical synthesis. N,N-Dimethyllactamide exhibits moderate viscosity and has a relatively high boiling point compared to other amides, indicating strong intermolecular interactions. Additionally, it is stable under normal conditions but should be handled with care due to potential irritant properties. Its chemical structure allows it to participate in various reactions, making it valuable in the fields of organic chemistry and pharmaceuticals. Overall, N,N-Dimethyllactamide is a versatile compound with significant utility in both industrial and laboratory settings.
Formula:C5H11NO2
InChI:InChI=1S/C5H11NO2/c1-4(7)5(8)6(2)3/h4,7H,1-3H3
InChI key:InChIKey=YEBLAXBYYVCOLT-UHFFFAOYSA-N
SMILES:C(C(C)O)(N(C)C)=O
Synonyms:
  • Agnique AMD 3L
  • Ai3-15674
  • Lactamide, N,N-dimethyl-
  • N,N-Dimethyllactamide
  • NSC 72728
  • Propanamide, 2-hydroxy-N,N-dimethyl-
  • 2-Hydroxy-N,N-dimethylpropanamide
Found 4 products.