CAS 3513-04-0

(3β,12β,14β,17α)-3,8,12,14,17-Pentahydroxypregn-5-en-20-one

Description:

The chemical substance known as (3β,12β,14β,17α)-3,8,12,14,17-Pentahydroxypregn-5-en-20-one, with the CAS number 3513-04-0, is a steroid compound characterized by multiple hydroxyl (-OH) functional groups attached to its steroid backbone. This specific configuration of hydroxyl groups contributes to its biological activity, influencing its interaction with various receptors and enzymes in the body. The presence of the pregnene structure indicates that it is derived from the steroidogenesis pathway, which is crucial in the synthesis of steroid hormones. The compound's stereochemistry, denoted by the specific β and α configurations, plays a significant role in determining its pharmacological properties and biological effects. It may exhibit various physiological activities, including potential roles in hormonal regulation and metabolic processes. Due to its complex structure, it may also be of interest in medicinal chemistry and pharmacology for the development of therapeutic agents.

Formula: C₂₁H₃₂O₆

InChI: InChI=1S/C21H32O6/c1-12(22)19(25)8-9-21(27)18(19,3)16(24)11-15-17(2)6-5-14(23)10-13(17)4-7-20(15,21)26/h4,14-16,23-27H,5-11H2,1-3H3/t14-,15+,16+,17-,18+,19+,20-,21+/m0/s1

InChI key: InChIKey=ATMZVVNNICECKQ-MNSFQJRNSA-N

SMILES: O[C@@]12[C@@]3(O)[C@@]([C@]4(C)C(=CC3)C[C@@H](O)CC4)(C[C@@H](O)[C@]1(C)[C@@](C(C)=O)(O)CC2)[H]

Synonyms:

• Deacylmetaplexigenin
• 14β,17α-Pregn-5-en-20-one, 3β,8,12β,14,17-pentahydroxy-
• (3β,12β,14β,17α)-3,8,12,14,17-Pentahydroxypregn-5-en-20-one
• Desacetylmetaplexigenin
• Pregn-5-en-20-one, 3,8,12,14,17-pentahydroxy-, (3β,12β,14β,17α)-

Deacylmetaplexigenin

CAS: 3513-04-0

Formula: C₂₁H₃₂O₆

Molecular weight: 380.48

Ref: 7W-GY4977

Deacylmetaplexigenin

CAS: 3513-04-0

Formula: C₂₁H₃₂O₆

Purity: 95%~99%

Molecular weight: 380.481

Ref: BP-BP0458

Deacylmetaplexigenin

CAS: 3513-04-0

Deacylmetaplexigenin is a pregnane glycoside isolated from Asclepias incarnate.

Formula: C₂₁H₃₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 380.48

Ref: TM-T13638

Deacylmetaplexigenin

CAS: 3513-04-0

Deacylmetaplexigenin is a naturally occurring compound, which is a cardenolide derived from certain plant species. This bioactive molecule is primarily extracted from plants belonging to the Apocynaceae family. It operates by interacting with cellular pathways that regulate ion transport, particularly inhibiting sodium-potassium ATPase. This inhibition can lead to altered ion gradients across cell membranes, affecting cellular functions and signaling pathways.

Formula: C₂₁H₃₂O₆

Purity: Min. 95%

Molecular weight: 380.5 g/mol

Ref: 3D-DAA51304