CAS 35132-20-8: 1R,2R-1,2-Diphenylethylenediamine
Description:1R,2R-1,2-Diphenylethylenediamine is an organic compound characterized by its structure, which features two phenyl groups attached to a central ethylene diamine backbone. This compound is a chiral diamine, meaning it has two stereocenters, resulting in specific enantiomers that can exhibit different chemical behaviors. It is typically used in asymmetric synthesis and as a ligand in coordination chemistry due to its ability to form stable complexes with various metal ions. The presence of the two phenyl groups enhances its hydrophobic character, influencing its solubility in organic solvents. Additionally, 1R,2R-1,2-Diphenylethylenediamine can participate in various chemical reactions, including oxidation and acylation, making it valuable in synthetic organic chemistry. Its physical properties, such as melting point and boiling point, can vary based on purity and specific conditions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H16N2
InChI:InChI=1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14-/m1/s1
InChI key:InChIKey=PONXTPCRRASWKW-ZIAGYGMSSA-N
SMILES:NC(C=1C=CC=CC1)C(N)C=2C=CC=CC2
- Synonyms:
- ((1R,2R)-2-Amino-1,2-diphenylethyl)amine
- (+)-1,2-Diphenylethylenediamine
- (+)-Stilbenediamine
- (1R,2R)-(+)-1,2-Diphenyl-1,2-diaminoethane
- (1R,2R)-(+)-1,2-Diphenyl-1,2-ethane diamine
- (1R,2R)-(+)-1,2-Diphenylenediamine
- (1R,2R)-(+)-Diphenylethylenediamine
- (1R,2R)-1,2-Diamino-1,2-diphenylethane
- (1R,2R)-1,2-Diphenyl-1,2-ethanediamine
- (1R,2R)-1,2-Diphenylethan-1,2-diamine
- See more synonyms
- (1R,2R)-1,2-diphenylethane-1,2-diamine
- (1R,2R)-1,2-diphenylethane-1,2-diaminium
- (1R,2R)-Diphenylethanediamine
- (R,R)-(+)-1,2-Diphenyl-1,2-diaminoethane
- (R,R)-(+)-Stilbenediamine
- (R,R)-1,2-Diamino-1,2-diphenylethane
- (R,R)-1,2-Diphenyl-1,2-ethanediamine
- (R,R)-1,2-Diphenylethylenediamine
- (R,R)-Dpen
- 1,2-Ethanediamine, 1,2-diphenyl-, (1R,2R)-
- 1,2-Ethanediamine, 1,2-diphenyl-, [R-(R*,R*)]-
- 1R,2R-(+)-1,2-Diphenylethanediamine
- 1R,2R-diphenyl ethylene diamine
