CAS 351329-88-9: N-(3,5-Dimethyladamantan-1-yl)formamide
Description:N-(3,5-Dimethyladamantan-1-yl)formamide is an organic compound characterized by its unique structure, which includes an adamantane core modified with a formamide functional group. This compound features a bulky, rigid framework due to the adamantane structure, which contributes to its potential biological activity and interaction with various biological targets. The presence of the formamide group introduces polar characteristics, enhancing its solubility in polar solvents compared to non-polar hydrocarbons. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the steric hindrance provided by the dimethyl substituents on the adamantane ring, which can affect binding affinity and selectivity towards specific receptors or enzymes. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the functional groups present. Overall, N-(3,5-Dimethyladamantan-1-yl)formamide represents a fascinating example of how structural modifications can lead to diverse chemical and biological properties.
Formula:C13H21NO
InChI:InChI=1S/C13H21NO/c1-11-3-10-4-12(2,6-11)8-13(5-10,7-11)14-9-15/h9-10H,3-8H2,1-2H3,(H,14,15)
InChI key:InChIKey=NYQWYYMEIBHRSB-UHFFFAOYSA-N
SMILES:O=CNC12CC3CC(C)(C1)CC(C)(C3)C2
- Synonyms:
- (3,5-Dimethyladamantan-1-yl)formamide
- 1-Formylamino-3,5-dimethyladamantane
- Formamide, N-(3,5-dimethyltricyclo[3.3.1.1<sup>3,7</sup>]dec-1-yl)-
- N-(3,5-Dimethyltricyclo[3.3.1.1<sup>3,7</sup>]dec-1-yl)formamide
- N-Formyl Memantine
- N-Formyl-3,5-dimethyladamantane-1-amine
