CAS 35134-07-7
:2-Formyl-3-methoxythiophene
Description:
2-Formyl-3-methoxythiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a formyl group (-CHO) at the second position and a methoxy group (-OCH3) at the third position of the thiophene ring, contributing to its reactivity and potential applications in organic synthesis. The presence of these functional groups allows for various chemical transformations, making it useful in the synthesis of more complex molecules. 2-Formyl-3-methoxythiophene is typically a yellow to brown solid, and its properties include moderate solubility in organic solvents. It may exhibit interesting optical and electronic properties due to the conjugated system of the thiophene ring. Additionally, this compound can participate in various reactions, such as nucleophilic additions and condensation reactions, which are valuable in the development of pharmaceuticals and agrochemicals. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C6H6O2S
InChI:InChI=1S/C6H6O2S/c1-8-5-2-3-9-6(5)4-7/h2-4H,1H3
InChI key:KGJDTMQUUPIAEF-UHFFFAOYSA-N
SMILES:COC1=C(SC=C1)C=O
Synonyms:- 3-Methoxythiophene-2-carboxaldehyde
- 2-Thiophenecarboxaldehyde, 3-methoxy-
- 3-Methoxythiophene-2-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Methoxythiophene-2-carboxaldehyde, 97%
CAS:3-Methoxythiophene-2-carboxaldehyde is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code orFormula:C6H6O2SPurity:97%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:142.173-Methoxythiophene-2-carboxaldehyde
CAS:3-Methoxythiophene-2-carboxaldehydeFormula:C6H6O2SPurity:≥95%Color and Shape:SolidMolecular weight:142.175632-Thiophenecarboxaldehyde, 3-methoxy-
CAS:Formula:C6H6O2SPurity:97%Color and Shape:SolidMolecular weight:142.17563-Methoxythiophene-2-carbaldehyde
CAS:3-Methoxythiophene-2-carbaldehydeFormula:C6H6O2SPurity:95%Molecular weight:142.183-Methoxythiophene-2-carbaldehyde
CAS:Formula:C6H6O2SPurity:97%Color and Shape:SolidMolecular weight:142.173-Methoxythiophene-2-carbaldehyde
CAS:3-Methoxythiophene-2-carbaldehyde is a ligand that has been shown to form a stable complex with potassium chloride. This compound is also reactive, and can be stabilized in the reaction vessel. In the presence of sulfate ions, 3-methoxythiophene-2-carbaldehyde will react to form a phosphotungstic acid precipitate. The dehydrated salt can be recrystallized by adding phosphotungstic acid, which stabilizes the product.
Formula:C6H6O2SPurity:Min. 95%Molecular weight:142.18 g/mol





