CymitQuimica logo

CAS 35139-68-5

:

(2E)-6-amino-4,5-dichloro-2-iminopyrimidin-1(2H)-ol

Description:
(2E)-6-amino-4,5-dichloro-2-iminopyrimidin-1(2H)-ol, with the CAS number 35139-68-5, is a chemical compound that belongs to the class of pyrimidines, which are heterocyclic aromatic organic compounds. This substance features a pyrimidine ring substituted with amino and dichloro groups, contributing to its unique reactivity and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and could act as a nucleophile in various chemical reactions. The dichloro substituents enhance its electrophilic character, making it potentially useful in synthetic applications. Additionally, the compound's imino and hydroxyl functionalities may impart specific solubility characteristics and influence its interaction with biological targets. Overall, this compound's structural features suggest it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C4H4Cl2N4O
InChI:InChI=1/C4H4Cl2N4O/c5-1-2(6)9-4(8)10(11)3(1)7/h8,11H,7H2/b8-4+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.