CAS 351421-19-7
:[(3S,4R,5S,6Z)-5-acetamido-3,4-diacetoxy-6-[(4-nitrophenyl)carbamoyloxyimino]tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4R,5S,6Z)-5-acetamido-3,4-diacetoxy-6-[(4-nitrophenyl)carbamoyloxyimino]tetrahydropyran-2-yl]methyl acetate" and CAS number 351421-19-7 is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and includes multiple acetoxy and acetamido groups that contribute to its reactivity and solubility. The presence of a nitrophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure indicates it may exhibit specific biological activities, possibly related to enzyme inhibition or modulation. Its stereochemical configuration (3S, 4R, 5S) is crucial for its biological interactions, as chirality can significantly influence the pharmacodynamics and pharmacokinetics of a drug. Overall, this compound's unique characteristics make it a subject of interest in chemical research and potential therapeutic applications.
Formula:C21H24N4O12
InChI:InChI=1/C21H24N4O12/c1-10(26)22-17-19(35-13(4)29)18(34-12(3)28)16(9-33-11(2)27)36-20(17)24-37-21(30)23-14-5-7-15(8-6-14)25(31)32/h5-8,16-19H,9H2,1-4H3,(H,22,26)(H,23,30)/t16?,17-,18+,19+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
O-(2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-D-glucopyranosylidene)amino N-(4-nitrophenyl)carbamate
CAS:<p>O-(2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-D-glucopyranosylidene)amino N-(4-nitrophenyl)carbamate is a synthetic compound that has been modified with fluorine. The compound is an example of a glycosylation reaction, which is the process of joining two sugars to form a complex carbohydrate. It has been modified with Methylation and Click modification. O-(2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl)-D glucopyranosylidene)amino N-(4 nitrophenyl)carbamate also has a saccharide component and is classified as Polysaccharide. This compound can be custom synthesized for customers who need high purity or oligosaccharides.</p>Formula:C21H24N4O12Purity:Min. 95%Molecular weight:524.44 g/molO-(2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-D-glucopyranosylidene)amino N-(4-nitrophenyl)carbamate
CAS:<p>O-(2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-D-glucopyranosylidene)amino N-(4-nitrophenyl)carbamate is a modification of an oligosaccharide that is synthesized by the reaction of an alpha, beta unsaturated nitrophenyl carbamate with a 2,6-anhydro glucose. The product is a white solid that can be used as a source for polysaccharides and monosaccharides. It has been shown to be modified by methylation, glycosylation and fluorination.</p>Formula:C21H23N3O12Purity:Min. 95%Molecular weight:509.42 g/mol

