CAS 351422-76-9
:Methanesulfonothioic acid, S-(5-aminopentyl) ester, hydrobromide (1:1)
Description:
Methanesulfonothioic acid, S-(5-aminopentyl) ester, hydrobromide (1:1) is a chemical compound characterized by its sulfonothioic acid functional group, which features a methanesulfonyl moiety linked to a 5-aminopentyl chain. This compound is typically encountered as a hydrobromide salt, indicating the presence of bromide ions that can influence its solubility and stability in various solvents. The presence of the amino group suggests potential for reactivity, particularly in forming amide bonds or participating in nucleophilic reactions. The structure implies that it may exhibit properties typical of both sulfonic acids and amines, such as being a good leaving group in substitution reactions and potentially acting as a zwitterion in certain conditions. Its applications may span fields such as medicinal chemistry, where it could serve as an intermediate in the synthesis of biologically active compounds or as a reagent in organic synthesis. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.
Formula:C6H15NO2S2·BrH
InChI:InChI=1S/C6H15NO2S2.BrH/c1-11(8,9)10-6-4-2-3-5-7;/h2-7H2,1H3;1H
InChI key:InChIKey=CXOOWSIZRDGDQJ-UHFFFAOYSA-N
SMILES:S(CCCCCN)S(C)(=O)=O.Br
Synonyms:- Methanesulfonothioic acid, S-(5-aminopentyl) ester, hydrobromide
- Methanesulfonothioic acid, S-(5-aminopentyl) ester, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Aminopentyl Methanthiosulfonate Hydrobromide
CAS:Controlled ProductFormula:C6H15NO2S2·BrHColor and Shape:NeatMolecular weight:278.23
