CAS 35143-94-3

S-{(2R)-2-(acetylamino)-3-[(4-hydroxyphenyl)amino]-3-oxopropyl} ethanethioate

Description:

S-{(2R)-2-(acetylamino)-3-[(4-hydroxyphenyl)amino]-3-oxopropyl} ethanethioate, with the CAS number 35143-94-3, is a chemical compound that features a complex structure characterized by the presence of an acetylamino group, a hydroxyphenyl moiety, and a thioate functional group. This compound is likely to exhibit properties typical of thioesters, including susceptibility to hydrolysis and reactivity with nucleophiles. The presence of the acetylamino group suggests potential for biological activity, possibly influencing interactions with enzymes or receptors. The hydroxyphenyl group may contribute to the compound's solubility and stability in various solvents, as well as its potential for forming hydrogen bonds. Overall, the compound's structure indicates it may have applications in medicinal chemistry or as a biochemical probe, although specific biological activities would require further investigation. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography to isolate the desired product.

Formula: C₁₃H₁₆N₂O₄S

InChI: InChI=1/C13H16N2O4S/c1-8(16)14-12(7-20-9(2)17)13(19)15-10-3-5-11(18)6-4-10/h3-6,12,18H,7H2,1-2H3,(H,14,16)(H,15,19)/t12-/m0/s1

Z 2004

CAS: 35143-94-3

Z 2004 is a bioactive chemical.

Formula: C₁₃H₁₆N₂O₄S

Color and Shape: Solid

Molecular weight: 296.34

Ref: TM-T35287