CymitQuimica logo

CAS 351439-07-1

:

methyl 1H-pyrrolo[2,3-b]pyridine-4-carboxylate

Description:
Methyl 1H-pyrrolo[2,3-b]pyridine-4-carboxylate is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. This compound typically appears as a solid or liquid depending on its purity and specific conditions. It features a carboxylate functional group, which enhances its reactivity and solubility in polar solvents. The presence of the methyl ester group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. Methyl 1H-pyrrolo[2,3-b]pyridine-4-carboxylate is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and anticancer properties. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by substituents on the pyridine and pyrrole rings, which can affect its interaction with biological targets. Overall, this compound represents a valuable scaffold for the development of new pharmaceuticals and agrochemicals.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c1-13-9(12)7-3-5-11-8-6(7)2-4-10-8/h2-5H,1H3,(H,10,11)
InChI key:CKCBQXQNAUHBDX-UHFFFAOYSA-N
SMILES:COC(=O)c1cc[nH]c2c1ccn2
Synonyms:
  • Mehyl7-azaindole-4-carboxylate
  • 1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid, methyl ester
  • Methyl-1H-pyrrolo[2,3-b]pyridin-4-carboxylat
Found 5 products.