CAS 351457-64-2

{1-[tert-butyl(dimethyl)silyl]-1H-indol-4-yl}boronic acid

Description:

{1-[tert-butyl(dimethyl)silyl]-1H-indol-4-yl}boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group, specifically an indole structure. This compound features a tert-butyl group and a dimethylsilyl moiety, which contribute to its hydrophobic properties and stability. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them useful in various applications, including organic synthesis and medicinal chemistry. The presence of the indole ring suggests potential biological activity, as indoles are common in many natural products and pharmaceuticals. Additionally, the silyl group enhances the compound's solubility and stability under certain conditions. Overall, this compound is significant in the field of organic chemistry, particularly in the development of new materials and drug discovery, due to its unique structural features and reactivity.

Formula: C₁₄H₂₂BNO₂Si

InChI: InChI=1/C14H22BNO2Si/c1-14(2,3)19(4,5)16-10-9-11-12(15(17)18)7-6-8-13(11)16/h6-10,17-18H,1-5H3

SMILES: CC(C)(C)[Si](C)(C)n1ccc2c(cccc12)B(O)O

1-TBDMS-indole-4-boronic acid

CAS: 351457-64-2

Formula: C₁₄H₂₂BNO₂Si

Purity: %

Color and Shape: Solid

Molecular weight: 275.2265

Ref: IN-DA007FL4

1-(tert-Butyldimethylsilyl)-1H-indole-4-boronic acid

CAS: 351457-64-2

1-(tert-Butyldimethylsilyl)-1H-indole-4-boronic acid

Formula: C₁₄H₂₂BNO₂Si

Purity: 98%

Color and Shape: white solid

Molecular weight: 275.23g/mol

Ref: 54-OR9553

(1-(Tert-butyldimethylsilyl)-1H-indol-4-yl)boronic acid

CAS: 351457-64-2

Purity: 98+%

Molecular weight: 275.230011

Ref: 10-F691652