CAS 35149-13-4

5,6,7,8-Tetrahydro-5-quinoxalinol

Description:

5,6,7,8-Tetrahydro-5-quinoxalinol is a chemical compound characterized by its bicyclic structure, which includes a quinoxaline moiety. This compound features a saturated tetrahydro configuration, indicating the presence of four hydrogen atoms that contribute to its stability and reactivity. It is typically a white to off-white solid at room temperature and is soluble in various organic solvents, which makes it useful in synthetic organic chemistry. The compound is of interest in medicinal chemistry due to its potential biological activities, including neuroprotective and antidepressant effects. Its structure allows for various functional group modifications, which can enhance its pharmacological properties. Additionally, 5,6,7,8-Tetrahydro-5-quinoxalinol may serve as a precursor or intermediate in the synthesis of more complex molecules. As with many organic compounds, handling should be done with care, considering safety protocols to avoid exposure. Overall, this compound exemplifies the intersection of structural complexity and potential therapeutic application in the field of chemistry.

Formula: C₈H₁₀N₂O

InChI: InChI=1S/C8H10N2O/c11-7-3-1-2-6-8(7)10-5-4-9-6/h4-5,7,11H,1-3H2

InChI key: InChIKey=LYSCEKSEDXBGNS-UHFFFAOYSA-N

SMILES: OC1C=2C(CCC1)=NC=CN2

Synonyms:

• 5,6,7,8-Tetrahydro-5-quinoxalinol
• 5-Quinoxalinol, 5,6,7,8-tetrahydro-

5,6,7,8-Tetrahydroquinoxalin-5-ol

CAS: 35149-13-4

5,6,7,8-Tetrahydroquinoxalin-5-ol is a chiral compound that can be used to synthesize carboxylic acid derivatives. It is prepared by the catalytic hydrogenation of 5-(hydroxymethyl)tetrahydroquinoxaline-2,3(1H)-dione (1). The enantiomeric purity of this compound can be determined by its reaction with sulfuryl chloride in hydrochloric acid (HCl) to yield the corresponding sulfonyl chloride. This reaction forms an asymmetric sulfonamide that can then be separated by crystallization.

Formula: C₈H₁₀N₂O

Purity: Min. 95%

Molecular weight: 150.18 g/mol

Ref: 3D-KBA14913