CAS 35149-38-3

5,7-dimethylpyrazolo[1,5-a]pyrimidine

Description:

5,7-Dimethylpyrazolo[1,5-a]pyrimidine is a heterocyclic organic compound characterized by its fused pyrazole and pyrimidine rings. This compound features two methyl groups located at the 5 and 7 positions of the pyrazole ring, which contribute to its unique chemical properties. It is typically a crystalline solid and is soluble in various organic solvents. The presence of nitrogen atoms in its structure imparts basicity and potential reactivity, making it of interest in medicinal chemistry and drug development. This compound may exhibit biological activity, including potential anti-inflammatory or anti-cancer properties, due to its structural similarity to other bioactive heterocycles. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 5,7-dimethylpyrazolo[1,5-a]pyrimidine represents a valuable scaffold in the exploration of new therapeutic agents.

Formula: C₈H₉N₃

InChI: InChI=1/C8H9N3/c1-6-5-7(2)11-8(10-6)3-4-9-11/h3-5H,1-2H3

SMILES: Cc1cc(C)n2c(ccn2)n1

Synonyms:

• Pyrazolo[1,5-A]Pyrimidine, 5,7-Dimethyl-

5,7-Dimethylpyrazolo[1,5-a]pyrimidine

CAS: 35149-38-3

Formula: C₈H₉N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.1772

Ref: IN-DA00CLB4

5,7-Dimethylpyrazolo[1,5-a]pyrimidine

CAS: 35149-38-3

5,7-Dimethylpyrazolo[1,5-a]pyrimidine

Purity: 95%

Molecular weight: 147.18g/mol

Ref: 54-OR930461

5,7-Dimethylpyrazolo[1,5-a]pyrimidine

CAS: 35149-38-3

Formula: C₈H₉N₃

Purity: 98%

Molecular weight: 147.181

Ref: 10-F335809

5,7-Dimethylpyrazolo[1,5-a]pyrimidine

CAS: 35149-38-3

Chlorpromazine is a potent antipsychotic drug that is used to treat mental disorders such as schizophrenia and bipolar disorder. It works by blocking the action of dopamine, a neurotransmitter in the brain. Chlorpromazine has minimal acute toxicity in animals and low potential for abuse or addiction. The most common side effects are drowsiness, dry mouth, nausea, and sedation. Chlorpromazine can interact with other drugs such as diazepam or chlorodiazepoxide to produce an anxiolytic effect. It also interacts with analgesics to produce depressant effects by increasing their sedative properties. In monkeys, chlorpromazine has been shown to have anxiolytic efficacy and depressant effects when given at high doses.

Formula: C₈H₉N₃

Purity: Min. 95%

Molecular weight: 147.17 g/mol

Ref: 3D-KBA14938