CAS 351521-78-3

4,4'-(9H-Fluorene-9,9-diyl)di(1,2-benzenediol)

Description:

4,4'-(9H-Fluorene-9,9-diyl)di(1,2-benzenediol), with the CAS number 351521-78-3, is an organic compound characterized by its unique structure that features a fluorene moiety connected to two 1,2-benzenediol units. This compound exhibits properties typical of polycyclic aromatic compounds, including potential fluorescence and photostability due to the presence of the fluorene structure. The diol groups contribute to its ability to form hydrogen bonds, which can influence solubility and reactivity. Additionally, the compound may exhibit antioxidant properties due to the presence of the hydroxyl groups in the benzenediol units. Its molecular structure suggests potential applications in organic electronics, such as in light-emitting diodes (LEDs) or as a building block for more complex materials. The compound's stability and reactivity can be influenced by factors such as pH and the presence of other chemical species, making it of interest in various fields, including materials science and organic chemistry.

Formula: C₂₅H₁₈O₄

InChI: InChI=1S/C25H18O4/c26-21-11-9-15(13-23(21)28)25(16-10-12-22(27)24(29)14-16)19-7-3-1-5-17(19)18-6-2-4-8-20(18)25/h1-14,26-29H

SMILES: c1ccc2c(c1)c1ccccc1C2(c1ccc(c(c1)O)O)c1ccc(c(c1)O)O

Synonyms:

• 1,2-Benzenediol, 4,4'-(9H-fluoren-9-ylidene)bis-
• 9,9-Bis(3,4-Dihydroxyphenyl)Fluorene

4-[9-(3,4-dihydroxyphenyl)-9H-fluoren-9-yl]benzene-1,2-diol

CAS: 351521-78-3

Formula: C₂₅H₁₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 382.4080

Ref: IN-DA00IMD7

9,9-Bis(3,4-Dihydroxyphenyl)Fluorene

CAS: 351521-78-3

9,9-Bis(3,4-Dihydroxyphenyl)Fluorene

Purity: 98%

Molecular weight: 382.42g/mol

Ref: 54-OR1024966

9,9-Bis(3,4-dihydroxyphenyl)fluorene

CAS: 351521-78-3

Formula: C₂₅H₁₈O₄

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 382.42

Ref: 3B-B4665