CAS 35153-15-2
:(Z)-9-Tetradecen-1-ol
Description:
(Z)-9-Tetradecen-1-ol, with the CAS number 35153-15-2, is a long-chain unsaturated fatty alcohol characterized by its specific molecular structure, which includes a 14-carbon chain and a double bond located at the ninth carbon from the end of the chain. This compound is typically found in various natural sources, including certain plant oils and animal fats. It is known for its role in the synthesis of pheromones and as a potential intermediate in the production of surfactants and emulsifiers. The (Z) configuration indicates that the hydrogen atoms adjacent to the double bond are on the same side, which influences its physical properties, such as melting and boiling points. (Z)-9-Tetradecen-1-ol is generally a colorless to pale yellow liquid with a characteristic odor, and it is soluble in organic solvents but has limited solubility in water. Its applications extend to the fragrance industry, cosmetics, and as a potential bioactive compound in various biochemical processes.
Formula:C14H28O
InChI:InChI=1S/C14H28O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15/h5-6,15H,2-4,7-14H2,1H3/b6-5-
InChI key:InChIKey=GSAAJQNJNPBBSX-WAYWQWQTSA-N
SMILES:C(C/C=C\CCCC)CCCCCCO
Synonyms:- (9Z)-9-Tetradecen-1-ol
- (Z)-9-Tetradecen-1-ol
- (Z)-9-Tetradecenyl alcohol
- 9-(Z)-Tetradecen-1-ol
- 9-Tetradecen-1-ol, (9Z)-
- 9-Tetradecen-1-ol, (Z)-
- 9-cis-Tetradecenol
- 9Z-Tetradecen-1-ol
- Myristoleyl alcohol
- cis-9-Tetradecen-1-ol
- cis-9-Tetradecenol
- cis-Δ<sup>9</sup>-Tetradecenol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
9-Tetradecen-1-ol, (9Z)-
CAS:Formula:C14H28OPurity:95%Color and Shape:LiquidMolecular weight:212.37159(Z)-Tetradecenol
CAS:Formula:C14H28OPurity:>99%Color and Shape:B) Odour Colourless OilMolecular weight:212.379(Z)-Tetradecenol
CAS:<p>9(Z)-Tetradecenol is a synthetic chemical that is used as an insecticide. It has been shown to have a high binding activity against the fatty acid in the cell membrane of lepidoptera, which disrupts the integrity of the membrane and leads to cell death by lysis. 9(Z)-Tetradecenol has also been found to bind to metal surfaces. 9(Z)-Tetradecenol is soluble in water, which makes it suitable for use in water-based formulations. This compound can be classified as a target pest because it only affects insects and not other organisms such as birds or mammals. It is active against a number of different species including lepidoptera, mosquitoes, aphids, and termites.</p>Formula:C14H28OPurity:Min. 95%Molecular weight:212.37 g/mol



